| 
|  | AZD8931Description of:AZD8931AZD8931 is a novel potent reversible small molecule epidermal growth factor receptor, ERBB2 (HER2) and ERBB3 inhibitor w...
 More>> |  | 
| 
|  | BMS-599626Description of:BMS-599626BMS-599626 inhibits human epidermal growth factor receptors (HER) HER1, HER2 and HER4, thereby inhibiting the prolife...
 More>> |  | 
| 
|  | CUDC101Description of:CUDC101CUDC-101 is a drug which displays potent in vitro inhibitory activity against HDAC, EGFR, and HER2 with an IC50 of 4.4, ...
 More>> |  | 
| 
|  | Canertinib(CI-1033)Description of:Canertinib(CI-1033)CI-1033 effectively inhibits the growth of esophageal squamous cell carcinoma which co-expresses both EGFR a...
 More>> |  | 
| 
|  | Canertinib dihydrochlorideDescription of:Canertinib dihydrochlorideAn orally bioavailable tyrosine kinase inhibitor, targeting EGFR, irreversibly inhibiting their...
 More>> |  |